C15H14F3N3 — CID 110454799
1-pyridin-2-yl-4-(2,3,4-trifluorophenyl)piperazine (PubChem CID 110454799) has the molecular formula C15H14F3N3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-pyridin-2-yl-4-(2,3,4-trifluorophenyl)piperazine.
| Compound Name | 1-pyridin-2-yl-4-(2,3,4-trifluorophenyl)piperazine |
|---|---|
| PubChem CID | 110454799 |
| Molecular Formula | C15H14F3N3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-pyridin-2-yl-4-(2,3,4-trifluorophenyl)piperazine |
| SMILES | Fc1ccc(N2CCN(c3ccccn3)CC2)c(F)c1F |
| InChI | InChI=1S/C15H14F3N3/c16-11-4-5-12(15(18)14(11)17)20-7-9-21(10-8-20)13-3-1-2-6-19-13/h1-6H,7-10H2 |
| InChIKey | CWMXBDQQSKWTGG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|