C14H11Cl2N — CID 110455009
1-(3,5-dichlorophenyl)-2,3-dihydroindole (PubChem CID 110455009) has the molecular formula C14H11Cl2N and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2,3-dihydroindole.
| Compound Name | 1-(3,5-dichlorophenyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 110455009 |
| Molecular Formula | C14H11Cl2N |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2,3-dihydroindole |
| SMILES | Clc1cc(Cl)cc(N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C14H11Cl2N/c15-11-7-12(16)9-13(8-11)17-6-5-10-3-1-2-4-14(10)17/h1-4,7-9H,5-6H2 |
| InChIKey | VXHYAWLZSAGCDZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |