C17H22N2O2 — CID 11045523
[7-(prop-2-ynylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] N-ethyl-N-methylcarbamate (PubChem CID 11045523) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [7-(prop-2-ynylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] N-ethyl-N-methylcarbamate.
| Compound Name | [7-(prop-2-ynylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 11045523 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [7-(prop-2-ynylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] N-ethyl-N-methylcarbamate |
| SMILES | C#CCNC1CCc2ccc(OC(=O)N(C)CC)cc2C1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-10-18-15-8-6-13-7-9-16(12-14(13)11-15)21-17(20)19(3)5-2/h1,7,9,12,15,18H,5-6,8,10-11H2,2-3H3 |
| InChIKey | LHCNMMLMHAYVJW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|