C18H17N3OS — CID 11045545
(3-methyl-1-sulfanylidene-3,4,4a,5-tetrahydro-2H-pyrimido[1,6-a]benzimidazol-8-yl)-phenylmethanone (PubChem CID 11045545) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is (3-methyl-1-sulfanylidene-3,4,4a,5-tetrahydro-2H-pyrimido[1,6-a]benzimidazol-8-yl)-phenylmethanone.
| Compound Name | (3-methyl-1-sulfanylidene-3,4,4a,5-tetrahydro-2H-pyrimido[1,6-a]benzimidazol-8-yl)-phenylmethanone |
|---|---|
| PubChem CID | 11045545 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (3-methyl-1-sulfanylidene-3,4,4a,5-tetrahydro-2H-pyrimido[1,6-a]benzimidazol-8-yl)-phenylmethanone |
| SMILES | CC1CC2Nc3ccc(C(=O)c4ccccc4)cc3N2C(=S)N1 |
| InChI | InChI=1S/C18H17N3OS/c1-11-9-16-20-14-8-7-13(10-15(14)21(16)18(23)19-11)17(22)12-5-3-2-4-6-12/h2-8,10-11,16,20H,9H2,1H3,(H,19,23) |
| InChIKey | WYSIBTOFIMDDQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|