About 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide
3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide (PubChem CID 11045566) has the molecular formula C16H12N4O2S
and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide |
| PubChem CID | 11045566 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccnc1C(=O)Nc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C16H12N4O2S/c21-14(11-5-2-1-3-6-11)19-12-7-4-8-17-13(12)15(22)20-16-18-9-10-23-16/h1-10H,(H,19,21)(H,18,20,22) |
| InChIKey | BOMLSFCDGFXWEI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide?
The IUPAC name of 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide (CID 11045566) is 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide.
What is the SMILES notation for 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide?
The canonical SMILES for 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide is O=C(Nc1cccnc1C(=O)Nc1nccs1)c1ccccc1.
What is the InChIKey of 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide?
The InChIKey is BOMLSFCDGFXWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2S/c21-14(11-5-2-1-3-6-11)19-12-7-4-8-17-13(12)15(22)20-16-18-9-10-23-16/h1-10H,(H,19,21)(H,18,20,22).
What are the key properties of 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide?
3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide has a molecular weight of 324.37 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzamido-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide is sourced from PubChem (CID 11045566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).