C17H16N4O3 — CID 110455791
N-[6-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]furan-2-carboxamide (PubChem CID 110455791) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[6-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]furan-2-carboxamide.
| Compound Name | N-[6-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110455791 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[6-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc2n(n1)CC(c1ccccc1O)CC2)c1ccco1 |
| InChI | InChI=1S/C17H16N4O3/c22-13-5-2-1-4-12(13)11-7-8-15-18-17(20-21(15)10-11)19-16(23)14-6-3-9-24-14/h1-6,9,11,22H,7-8,10H2,(H,19,20,23) |
| InChIKey | QMQITVARZIKOEU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |