About (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol
(1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol (PubChem CID 11045598) has the molecular formula C17H19N5O2
and a molecular weight of 325.37 g/mol. Its IUPAC name is (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol |
| PubChem CID | 11045598 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol |
| SMILES | C[C@@H](O)c1nccc(N2CCN(c3nc4ccccc4o3)CC2)n1 |
| InChI | InChI=1S/C17H19N5O2/c1-12(23)16-18-7-6-15(20-16)21-8-10-22(11-9-21)17-19-13-4-2-3-5-14(13)24-17/h2-7,12,23H,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | OBYRNXCGKYKCDK-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol?
The IUPAC name of (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol (CID 11045598) is (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol.
What is the SMILES notation for (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol?
The canonical SMILES for (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol is C[C@@H](O)c1nccc(N2CCN(c3nc4ccccc4o3)CC2)n1.
What is the InChIKey of (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol?
The InChIKey is OBYRNXCGKYKCDK-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H19N5O2/c1-12(23)16-18-7-6-15(20-16)21-8-10-22(11-9-21)17-19-13-4-2-3-5-14(13)24-17/h2-7,12,23H,8-11H2,1H3/t12-/m1/s1.
What are the key properties of (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol?
(1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol has a molecular weight of 325.37 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[4-[4-(1,3-benzoxazol-2-yl)piperazin-1-yl]pyrimidin-2-yl]ethanol is sourced from PubChem (CID 11045598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).