C17H27NO5 — CID 11045602
(3S,4S,5S)-3-[(E)-3-[(2R,3R)-3-heptyloxiran-2-yl]prop-2-enoyl]-3,4-dihydroxy-5-methylpyrrolidin-2-one (PubChem CID 11045602) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3S,4S,5S)-3-[(E)-3-[(2R,3R)-3-heptyloxiran-2-yl]prop-2-enoyl]-3,4-dihydroxy-5-methylpyrrolidin-2-one.
| Compound Name | (3S,4S,5S)-3-[(E)-3-[(2R,3R)-3-heptyloxiran-2-yl]prop-2-enoyl]-3,4-dihydroxy-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11045602 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (3S,4S,5S)-3-[(E)-3-[(2R,3R)-3-heptyloxiran-2-yl]prop-2-enoyl]-3,4-dihydroxy-5-methylpyrrolidin-2-one |
| SMILES | CCCCCCC[C@H]1O[C@@H]1/C=C/C(=O)[C@]1(O)C(=O)N[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H27NO5/c1-3-4-5-6-7-8-12-13(23-12)9-10-14(19)17(22)15(20)11(2)18-16(17)21/h9-13,15,20,22H,3-8H2,1-2H3,(H,18,21)/b10-9+/t11-,12+,13+,15-,17+/m0/s1 |
| InChIKey | ZITQOKSHWTVTEJ-HRRKUFDYSA-N |
| XLogP | 0.85 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|