C14H13N3O2S — CID 110456182
N-benzyl-5-(3-methoxythiophen-2-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 110456182) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-benzyl-5-(3-methoxythiophen-2-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-benzyl-5-(3-methoxythiophen-2-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110456182 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-benzyl-5-(3-methoxythiophen-2-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | COc1ccsc1-c1nnc(NCc2ccccc2)o1 |
| InChI | InChI=1S/C14H13N3O2S/c1-18-11-7-8-20-12(11)13-16-17-14(19-13)15-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,15,17) |
| InChIKey | ADMHMTPLMGQLMQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |