About 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide
2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide (PubChem CID 110457058) has the molecular formula C11H12Cl2N2O
and a molecular weight of 259.14 g/mol. Its IUPAC name is 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
| PubChem CID | 110457058 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide |
| SMILES | NC(=O)CN1CCc2c(Cl)cc(Cl)cc2C1 |
| InChI | InChI=1S/C11H12Cl2N2O/c12-8-3-7-5-15(6-11(14)16)2-1-9(7)10(13)4-8/h3-4H,1-2,5-6H2,(H2,14,16) |
| InChIKey | VLGGZSPZDASRCT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide?
The IUPAC name of 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide (CID 110457058) is 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide.
What is the SMILES notation for 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide?
The canonical SMILES for 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide is NC(=O)CN1CCc2c(Cl)cc(Cl)cc2C1.
What is the InChIKey of 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide?
The InChIKey is VLGGZSPZDASRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O/c12-8-3-7-5-15(6-11(14)16)2-1-9(7)10(13)4-8/h3-4H,1-2,5-6H2,(H2,14,16).
What are the key properties of 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide?
2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide has a molecular weight of 259.14 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dichloro-3,4-dihydro-1H-isoquinolin-2-yl)acetamide is sourced from PubChem (CID 110457058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).