C19H28N2O4 — CID 110457290
tert-butyl N-[2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)ethyl]carbamate (PubChem CID 110457290) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is tert-butyl N-[2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 110457290 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | tert-butyl N-[2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCc2cc3c(cc2C1)OCCCO3 |
| InChI | InChI=1S/C19H28N2O4/c1-19(2,3)25-18(22)20-6-8-21-7-5-14-11-16-17(12-15(14)13-21)24-10-4-9-23-16/h11-12H,4-10,13H2,1-3H3,(H,20,22) |
| InChIKey | OCGNJEAMLADXPH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |