C20H27NO3 — CID 110457694
2-hexyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid (PubChem CID 110457694) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-hexyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid.
| Compound Name | 2-hexyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid |
|---|---|
| PubChem CID | 110457694 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-hexyl-1-oxospiro[4H-isoquinoline-3,1'-cyclopentane]-4-carboxylic acid |
| SMILES | CCCCCCN1C(=O)c2ccccc2C(C(=O)O)C12CCCC2 |
| InChI | InChI=1S/C20H27NO3/c1-2-3-4-9-14-21-18(22)16-11-6-5-10-15(16)17(19(23)24)20(21)12-7-8-13-20/h5-6,10-11,17H,2-4,7-9,12-14H2,1H3,(H,23,24) |
| InChIKey | KZLPTWMICXRSRK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|