C18H20N2O5 — CID 110458333
2-[(3E)-3-[[4-(morpholin-4-ylmethyl)phenyl]methylidene]-2,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 110458333) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(3E)-3-[[4-(morpholin-4-ylmethyl)phenyl]methylidene]-2,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(3E)-3-[[4-(morpholin-4-ylmethyl)phenyl]methylidene]-2,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 110458333 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[(3E)-3-[[4-(morpholin-4-ylmethyl)phenyl]methylidene]-2,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C/C(=C\c2ccc(CN3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C18H20N2O5/c21-16-10-15(18(24)20(16)12-17(22)23)9-13-1-3-14(4-2-13)11-19-5-7-25-8-6-19/h1-4,9H,5-8,10-12H2,(H,22,23)/b15-9+ |
| InChIKey | JWCZEACZTMZCAU-OQLLNIDSSA-N |
| XLogP | 0.75 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|