About 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine
5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine (PubChem CID 11045838) has the molecular formula C21H24N4
and a molecular weight of 332.45 g/mol. Its IUPAC name is 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine |
| PubChem CID | 11045838 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cc(N)cc1C(c1ccccc1)c1cc(N)cc(N)c1C |
| InChI | InChI=1S/C21H24N4/c1-12-17(8-15(22)10-19(12)24)21(14-6-4-3-5-7-14)18-9-16(23)11-20(25)13(18)2/h3-11,21H,22-25H2,1-2H3 |
| InChIKey | VFZHSLUPAFZOAO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine?
The IUPAC name of 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine (CID 11045838) is 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine.
What is the SMILES notation for 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine?
The canonical SMILES for 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine is Cc1c(N)cc(N)cc1C(c1ccccc1)c1cc(N)cc(N)c1C.
What is the InChIKey of 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine?
The InChIKey is VFZHSLUPAFZOAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4/c1-12-17(8-15(22)10-19(12)24)21(14-6-4-3-5-7-14)18-9-16(23)11-20(25)13(18)2/h3-11,21H,22-25H2,1-2H3.
What are the key properties of 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine?
5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine has a molecular weight of 332.45 g/mol, XLogP of 3.81, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-diamino-2-methylphenyl)-phenylmethyl]-4-methylbenzene-1,3-diamine is sourced from PubChem (CID 11045838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).