C14H18N6O2S — CID 110458823
N,N,4-trimethyl-2-(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-carbonylamino)-1,3-thiazole-5-carboxamide (PubChem CID 110458823) has the molecular formula C14H18N6O2S and a molecular weight of 334.41 g/mol. Its IUPAC name is N,N,4-trimethyl-2-(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-carbonylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N,N,4-trimethyl-2-(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-carbonylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110458823 |
| Molecular Formula | C14H18N6O2S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N,N,4-trimethyl-2-(4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine-3-carbonylamino)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NC(=O)c2n[nH]c3c2CNCC3)sc1C(=O)N(C)C |
| InChI | InChI=1S/C14H18N6O2S/c1-7-11(13(22)20(2)3)23-14(16-7)17-12(21)10-8-6-15-5-4-9(8)18-19-10/h15H,4-6H2,1-3H3,(H,18,19)(H,16,17,21) |
| InChIKey | LLUFJUWIQGBYIZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |