C19H18F2N4 — CID 110458909
4-[1-(2,6-difluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline (PubChem CID 110458909) has the molecular formula C19H18F2N4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[1-(2,6-difluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline.
| Compound Name | 4-[1-(2,6-difluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 110458909 |
| Molecular Formula | C19H18F2N4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[1-(2,6-difluorophenyl)-5-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline |
| SMILES | CN1CCc2c(c(-c3ccc(N)cc3)nn2-c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C19H18F2N4/c1-24-10-9-17-14(11-24)18(12-5-7-13(22)8-6-12)23-25(17)19-15(20)3-2-4-16(19)21/h2-8H,9-11,22H2,1H3 |
| InChIKey | KSKHTLHGTGUBAK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|