C17H22N2OS2 — CID 11045912
3-butylsulfanyl-6,6-dimethyl-1-(1H-pyrazol-5-yl)-5,7-dihydro-2-benzothiophen-4-one (PubChem CID 11045912) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 3-butylsulfanyl-6,6-dimethyl-1-(1H-pyrazol-5-yl)-5,7-dihydro-2-benzothiophen-4-one.
| Compound Name | 3-butylsulfanyl-6,6-dimethyl-1-(1H-pyrazol-5-yl)-5,7-dihydro-2-benzothiophen-4-one |
|---|---|
| PubChem CID | 11045912 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-butylsulfanyl-6,6-dimethyl-1-(1H-pyrazol-5-yl)-5,7-dihydro-2-benzothiophen-4-one |
| SMILES | CCCCSc1sc(-c2ccn[nH]2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H22N2OS2/c1-4-5-8-21-16-14-11(9-17(2,3)10-13(14)20)15(22-16)12-6-7-18-19-12/h6-7H,4-5,8-10H2,1-3H3,(H,18,19) |
| InChIKey | RDUGGSFEUGIIBT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|