C12H21N2O+ — CID 11045953
3-(4,4-dimethylpiperazin-4-ium-1-yl)cyclohex-2-en-1-one (PubChem CID 11045953) has the molecular formula C12H21N2O+ and a molecular weight of 209.31 g/mol. Its IUPAC name is 3-(4,4-dimethylpiperazin-4-ium-1-yl)cyclohex-2-en-1-one.
| Compound Name | 3-(4,4-dimethylpiperazin-4-ium-1-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11045953 |
| Molecular Formula | C12H21N2O+ |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-(4,4-dimethylpiperazin-4-ium-1-yl)cyclohex-2-en-1-one |
| SMILES | C[N+]1(C)CCN(C2=CC(=O)CCC2)CC1 |
| InChI | InChI=1S/C12H21N2O/c1-14(2)8-6-13(7-9-14)11-4-3-5-12(15)10-11/h10H,3-9H2,1-2H3/q+1 |
| InChIKey | IMDHNAHBFKYIMT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|