C21H24N2O2 — CID 11045973
(E)-3-[4-[2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enenitrile (PubChem CID 11045973) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (E)-3-[4-[2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11045973 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (E)-3-[4-[2-(2-cyclohexyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enenitrile |
| SMILES | Cc1oc(C2CCCCC2)nc1CCOc1ccc(/C=C/C#N)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-16-20(23-21(25-16)18-7-3-2-4-8-18)13-15-24-19-11-9-17(10-12-19)6-5-14-22/h5-6,9-12,18H,2-4,7-8,13,15H2,1H3/b6-5+ |
| InChIKey | NTBIECXZIJXRTI-AATRIKPKSA-N |
| XLogP | 5.19 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|