C19H33NO4 — CID 11046066
(6E,7R,8R,8aS)-6-[(E,2R,6R,7R)-6,7-dihydroxy-2,5-dimethyloct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizine-7,8-diol (PubChem CID 11046066) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is (6E,7R,8R,8aS)-6-[(E,2R,6R,7R)-6,7-dihydroxy-2,5-dimethyloct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizine-7,8-diol.
| Compound Name | (6E,7R,8R,8aS)-6-[(E,2R,6R,7R)-6,7-dihydroxy-2,5-dimethyloct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizine-7,8-diol |
|---|---|
| PubChem CID | 11046066 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (6E,7R,8R,8aS)-6-[(E,2R,6R,7R)-6,7-dihydroxy-2,5-dimethyloct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizine-7,8-diol |
| SMILES | C/C(=C\C[C@@H](C)/C=C1\CN2CCC[C@H]2[C@@](C)(O)[C@@H]1O)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C19H33NO4/c1-12(7-8-13(2)17(22)14(3)21)10-15-11-20-9-5-6-16(20)19(4,24)18(15)23/h8,10,12,14,16-18,21-24H,5-7,9,11H2,1-4H3/b13-8+,15-10+/t12-,14-,16+,17-,18-,19-/m1/s1 |
| InChIKey | ROTIYIHXOAYCEN-KDUHGIGYSA-N |
| XLogP | 1.22 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|