C18H21NO4S — CID 11046262
tert-butyl (1R,4S)-2-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate (PubChem CID 11046262) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is tert-butyl (1R,4S)-2-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate.
| Compound Name | tert-butyl (1R,4S)-2-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
|---|---|
| PubChem CID | 11046262 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl (1R,4S)-2-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C2=C[C@@H]3C=C[C@H]2N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-12-5-8-14(9-6-12)24(21,22)16-11-13-7-10-15(16)19(13)17(20)23-18(2,3)4/h5-11,13,15H,1-4H3/t13-,15+/m0/s1 |
| InChIKey | DSEJXEOLOHIGIZ-DZGCQCFKSA-N |
| XLogP | 3.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|