C15H28O7Si — CID 11046289
dimethyl (Z,2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6-dihydroxyhept-3-enedioate (PubChem CID 11046289) has the molecular formula C15H28O7Si and a molecular weight of 348.47 g/mol. Its IUPAC name is dimethyl (Z,2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6-dihydroxyhept-3-enedioate.
| Compound Name | dimethyl (Z,2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6-dihydroxyhept-3-enedioate |
|---|---|
| PubChem CID | 11046289 |
| Molecular Formula | C15H28O7Si |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | dimethyl (Z,2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6-dihydroxyhept-3-enedioate |
| SMILES | COC(=O)[C@H](O)/C=C(/C[C@@H](O)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O7Si/c1-15(2,3)23(6,7)22-10(8-11(16)13(18)20-4)9-12(17)14(19)21-5/h8,11-12,16-17H,9H2,1-7H3/b10-8-/t11-,12-/m1/s1 |
| InChIKey | XJSYHPOMWWTVSI-NRCZCXPTSA-N |
| XLogP | 1.35 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|