C22H42OSi — CID 11046358
[(2S,5R,8R,8aR)-2,5-dimethyl-8-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11046358) has the molecular formula C22H42OSi and a molecular weight of 350.66 g/mol. Its IUPAC name is [(2S,5R,8R,8aR)-2,5-dimethyl-8-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,5R,8R,8aR)-2,5-dimethyl-8-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11046358 |
| Molecular Formula | C22H42OSi |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | [(2S,5R,8R,8aR)-2,5-dimethyl-8-propan-2-yl-3,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C2=CC[C@](C)(CO[Si](C)(C)C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C22H42OSi/c1-16(2)18-11-10-17(3)19-12-13-22(7,14-20(18)19)15-23-24(8,9)21(4,5)6/h12,16-18,20H,10-11,13-15H2,1-9H3/t17-,18-,20-,22+/m1/s1 |
| InChIKey | FFAHHURHJQZOFQ-DBQGFPOUSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|