C14H20N2O3 — CID 110463600
N-[4-(dimethylamino)butyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 110463600) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)butyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110463600 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C)CCCCNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-16(2)8-4-3-7-15-14(17)11-5-6-12-13(9-11)19-10-18-12/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,15,17) |
| InChIKey | OIBXOCVDALFRDX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|