C24H17NO2 — CID 11046370
methyl 5,6-diphenyl-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2-carboxylate (PubChem CID 11046370) has the molecular formula C24H17NO2 and a molecular weight of 351.41 g/mol. Its IUPAC name is methyl 5,6-diphenyl-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2-carboxylate.
| Compound Name | methyl 5,6-diphenyl-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2-carboxylate |
|---|---|
| PubChem CID | 11046370 |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 5,6-diphenyl-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c(-c3ccccc3)c3cccc1n32 |
| InChI | InChI=1S/C24H17NO2/c1-27-24(26)18-15-21-23(17-11-6-3-7-12-17)22(16-9-4-2-5-10-16)20-14-8-13-19(18)25(20)21/h2-15H,1H3 |
| InChIKey | GHEDFKGEUSAWQC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |