About 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal
4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal (PubChem CID 11046453) has the molecular formula C22H30O2Si
and a molecular weight of 354.57 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal.
Molecular Properties
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal |
| PubChem CID | 11046453 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal |
| SMILES | CC(C)(C=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H30O2Si/c1-21(2,3)25(19-12-8-6-9-13-19,20-14-10-7-11-15-20)24-17-16-22(4,5)18-23/h6-15,18H,16-17H2,1-5H3 |
| InChIKey | QJYHBUVUYJYDGI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal?
The IUPAC name of 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal (CID 11046453) is 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal.
What is the SMILES notation for 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal?
The canonical SMILES for 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal is CC(C)(C=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal?
The InChIKey is QJYHBUVUYJYDGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O2Si/c1-21(2,3)25(19-12-8-6-9-13-19,20-14-10-7-11-15-20)24-17-16-22(4,5)18-23/h6-15,18H,16-17H2,1-5H3.
What are the key properties of 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal?
4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal has a molecular weight of 354.57 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutanal is sourced from PubChem (CID 11046453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).