C16H18N2O2 — CID 110464861
N-(3-methoxypropyl)-4-pyridin-2-ylbenzamide (PubChem CID 110464861) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-pyridin-2-ylbenzamide.
| Compound Name | N-(3-methoxypropyl)-4-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 110464861 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-(3-methoxypropyl)-4-pyridin-2-ylbenzamide |
| SMILES | COCCCNC(=O)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-20-12-4-11-18-16(19)14-8-6-13(7-9-14)15-5-2-3-10-17-15/h2-3,5-10H,4,11-12H2,1H3,(H,18,19) |
| InChIKey | KQPIAWDZKYZIPN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|