C4ClF8I — CID 11046660
1-chloro-1,1,2,2,3,3,4,4-octafluoro-4-iodobutane (PubChem CID 11046660) has the molecular formula C4ClF8I and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-chloro-1,1,2,2,3,3,4,4-octafluoro-4-iodobutane.
| Compound Name | 1-chloro-1,1,2,2,3,3,4,4-octafluoro-4-iodobutane |
|---|---|
| PubChem CID | 11046660 |
| Molecular Formula | C4ClF8I |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 361.86 |
| IUPAC Name | 1-chloro-1,1,2,2,3,3,4,4-octafluoro-4-iodobutane |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C4ClF8I/c5-3(10,11)1(6,7)2(8,9)4(12,13)14 |
| InChIKey | UTORKRMXLIPMRJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|