About N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide
N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 110467674) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| PubChem CID | 110467674 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1=NNC(=O)C1 |
| InChI | InChI=1S/C8H13N3O2/c1-8(2,3)9-7(13)5-4-6(12)11-10-5/h4H2,1-3H3,(H,9,13)(H,11,12) |
| InChIKey | KSQLSIJKTPSEGQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide?
The IUPAC name of N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide (CID 110467674) is N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide.
What is the SMILES notation for N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide?
The canonical SMILES for N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide is CC(C)(C)NC(=O)C1=NNC(=O)C1.
What is the InChIKey of N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide?
The InChIKey is KSQLSIJKTPSEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-8(2,3)9-7(13)5-4-6(12)11-10-5/h4H2,1-3H3,(H,9,13)(H,11,12).
What are the key properties of N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide?
N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide has a molecular weight of 183.21 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5-oxo-1,4-dihydropyrazole-3-carboxamide is sourced from PubChem (CID 110467674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).