C11H10N4O4 — CID 110467849
N-(2-methyl-3-nitrophenyl)-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 110467849) has the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-5-oxo-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-5-oxo-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110467849 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | Cc1c(NC(=O)C2=NNC(=O)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N4O4/c1-6-7(3-2-4-9(6)15(18)19)12-11(17)8-5-10(16)14-13-8/h2-4H,5H2,1H3,(H,12,17)(H,14,16) |
| InChIKey | YFYXYAIXJVCMIM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|