About 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide
5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide (PubChem CID 110470348) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide.
Molecular Properties
| Compound Name | 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide |
| PubChem CID | 110470348 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide |
| SMILES | CN(C)C(=O)n1ncc(C#N)c1N |
| InChI | InChI=1S/C7H9N5O/c1-11(2)7(13)12-6(9)5(3-8)4-10-12/h4H,9H2,1-2H3 |
| InChIKey | SQMXLQDWKDMVMR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide?
The IUPAC name of 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide (CID 110470348) is 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide.
What is the SMILES notation for 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide?
The canonical SMILES for 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide is CN(C)C(=O)n1ncc(C#N)c1N.
What is the InChIKey of 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide?
The InChIKey is SQMXLQDWKDMVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-11(2)7(13)12-6(9)5(3-8)4-10-12/h4H,9H2,1-2H3.
What are the key properties of 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide?
5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide has a molecular weight of 179.18 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-cyano-N,N-dimethylpyrazole-1-carboxamide is sourced from PubChem (CID 110470348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).