About 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide
3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 110470361) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide |
| PubChem CID | 110470361 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C9H19N3O/c1-10(2)8-5-6-12(7-8)9(13)11(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | DGJVNEMXBDRKEH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide?
The IUPAC name of 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide (CID 110470361) is 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide.
What is the SMILES notation for 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide?
The canonical SMILES for 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide is CN(C)C(=O)N1CCC(N(C)C)C1.
What is the InChIKey of 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide?
The InChIKey is DGJVNEMXBDRKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-10(2)8-5-6-12(7-8)9(13)11(3)4/h8H,5-7H2,1-4H3.
What are the key properties of 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide?
3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide has a molecular weight of 185.27 g/mol, XLogP of 0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-N,N-dimethylpyrrolidine-1-carboxamide is sourced from PubChem (CID 110470361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).