C21H20N4O3 — CID 11047052
17-amino-21-[2-(dimethylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one (PubChem CID 11047052) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 17-amino-21-[2-(dimethylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one.
| Compound Name | 17-amino-21-[2-(dimethylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
|---|---|
| PubChem CID | 11047052 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 17-amino-21-[2-(dimethylamino)ethyl]-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaen-20-one |
| SMILES | CN(C)CCn1c(=O)c2cc(N)ccc2c2cnc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C21H20N4O3/c1-24(2)5-6-25-20-15-8-18-19(28-11-27-18)9-17(15)23-10-16(20)13-4-3-12(22)7-14(13)21(25)26/h3-4,7-10H,5-6,11,22H2,1-2H3 |
| InChIKey | KLDVLVNWKNWWHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|