About N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide
N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide (PubChem CID 11047055) has the molecular formula C20H16N4O2S
and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide |
| PubChem CID | 11047055 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3cccnc3)c3ccccc23)sn1 |
| InChI | InChI=1S/C20H16N4O2S/c1-13-9-18(27-23-13)22-20(26)19(25)16-12-24(11-14-5-4-8-21-10-14)17-7-3-2-6-15(16)17/h2-10,12H,11H2,1H3,(H,22,26) |
| InChIKey | IXWKMQRSAWHHMV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide?
The IUPAC name of N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide (CID 11047055) is N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide.
What is the SMILES notation for N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide?
The canonical SMILES for N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide is Cc1cc(NC(=O)C(=O)c2cn(Cc3cccnc3)c3ccccc23)sn1.
What is the InChIKey of N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide?
The InChIKey is IXWKMQRSAWHHMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O2S/c1-13-9-18(27-23-13)22-20(26)19(25)16-12-24(11-14-5-4-8-21-10-14)17-7-3-2-6-15(16)17/h2-10,12H,11H2,1H3,(H,22,26).
What are the key properties of N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide?
N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide has a molecular weight of 376.44 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-(pyridin-3-ylmethyl)indol-3-yl]acetamide is sourced from PubChem (CID 11047055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).