C9H15N3O — CID 110470693
3-methyl-N-(2-methylpyrazol-3-yl)butanamide (PubChem CID 110470693) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpyrazol-3-yl)butanamide.
| Compound Name | 3-methyl-N-(2-methylpyrazol-3-yl)butanamide |
|---|---|
| PubChem CID | 110470693 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-methyl-N-(2-methylpyrazol-3-yl)butanamide |
| SMILES | CC(C)CC(=O)Nc1ccnn1C |
| InChI | InChI=1S/C9H15N3O/c1-7(2)6-9(13)11-8-4-5-10-12(8)3/h4-5,7H,6H2,1-3H3,(H,11,13) |
| InChIKey | HTUWCFOUDTYZQL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |