About ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate
ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate (PubChem CID 110470965) has the molecular formula C8H8F3N3O3
and a molecular weight of 251.16 g/mol. Its IUPAC name is ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate |
| PubChem CID | 110470965 |
| Molecular Formula | C8H8F3N3O3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O3/c1-2-17-6(15)4-3-12-14-5(4)13-7(16)8(9,10)11/h3H,2H2,1H3,(H2,12,13,14,16) |
| InChIKey | HVTOLYXGKQSZDV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate (CID 110470965) is ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1NC(=O)C(F)(F)F.
What is the InChIKey of ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate?
The InChIKey is HVTOLYXGKQSZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O3/c1-2-17-6(15)4-3-12-14-5(4)13-7(16)8(9,10)11/h3H,2H2,1H3,(H2,12,13,14,16).
What are the key properties of ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate?
ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate has a molecular weight of 251.16 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,2,2-trifluoroacetyl)amino]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 110470965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).