C13H17NO2 — CID 110470991
N-[(2-hydroxyphenyl)methyl]cyclopentanecarboxamide (PubChem CID 110470991) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)methyl]cyclopentanecarboxamide.
| Compound Name | N-[(2-hydroxyphenyl)methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110470991 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(2-hydroxyphenyl)methyl]cyclopentanecarboxamide |
| SMILES | O=C(NCc1ccccc1O)C1CCCC1 |
| InChI | InChI=1S/C13H17NO2/c15-12-8-4-3-7-11(12)9-14-13(16)10-5-1-2-6-10/h3-4,7-8,10,15H,1-2,5-6,9H2,(H,14,16) |
| InChIKey | AAIAUBWEZHOEMP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|