C15H20N4O — CID 110473260
3-(dimethylamino)-N-[1-(1-methylimidazol-2-yl)ethyl]benzamide (PubChem CID 110473260) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[1-(1-methylimidazol-2-yl)ethyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[1-(1-methylimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110473260 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(dimethylamino)-N-[1-(1-methylimidazol-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(N(C)C)c1)c1nccn1C |
| InChI | InChI=1S/C15H20N4O/c1-11(14-16-8-9-19(14)4)17-15(20)12-6-5-7-13(10-12)18(2)3/h5-11H,1-4H3,(H,17,20) |
| InChIKey | YMHQTNBFDWBEPW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |