C16H25N3O — CID 110473838
3-[4-(dimethylamino)phenyl]-N-(1-methylpyrrolidin-3-yl)propanamide (PubChem CID 110473838) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-(1-methylpyrrolidin-3-yl)propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-(1-methylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 110473838 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-(1-methylpyrrolidin-3-yl)propanamide |
| SMILES | CN1CCC(NC(=O)CCc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C16H25N3O/c1-18(2)15-7-4-13(5-8-15)6-9-16(20)17-14-10-11-19(3)12-14/h4-5,7-8,14H,6,9-12H2,1-3H3,(H,17,20) |
| InChIKey | HJCAJORKZZNOHA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|