C13H16N4O3 — CID 110475174
2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide (PubChem CID 110475174) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide.
| Compound Name | 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110475174 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide |
| SMILES | CN(C)c1ncccc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N4O3/c1-17(2)11-8(4-3-7-14-11)12(19)15-9-5-6-10(18)16-13(9)20/h3-4,7,9H,5-6H2,1-2H3,(H,15,19)(H,16,18,20) |
| InChIKey | MUFOSBMBEYNXQB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|