About 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide
2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide (PubChem CID 110475174) has the molecular formula C13H16N4O3
and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide |
| PubChem CID | 110475174 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide |
| SMILES | CN(C)c1ncccc1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H16N4O3/c1-17(2)11-8(4-3-7-14-11)12(19)15-9-5-6-10(18)16-13(9)20/h3-4,7,9H,5-6H2,1-2H3,(H,15,19)(H,16,18,20) |
| InChIKey | MUFOSBMBEYNXQB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide?
The IUPAC name of 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide (CID 110475174) is 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide.
What is the SMILES notation for 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide?
The canonical SMILES for 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide is CN(C)c1ncccc1C(=O)NC1CCC(=O)NC1=O.
What is the InChIKey of 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide?
The InChIKey is MUFOSBMBEYNXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3/c1-17(2)11-8(4-3-7-14-11)12(19)15-9-5-6-10(18)16-13(9)20/h3-4,7,9H,5-6H2,1-2H3,(H,15,19)(H,16,18,20).
What are the key properties of 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide?
2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide has a molecular weight of 276.30 g/mol, XLogP of -0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(2,6-dioxopiperidin-3-yl)pyridine-3-carboxamide is sourced from PubChem (CID 110475174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).