About N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide
N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide (PubChem CID 110475376) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide |
| PubChem CID | 110475376 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide |
| SMILES | CC(C)N1Cc2ccc(NC(=O)c3cnc[nH]3)cc2C1 |
| InChI | InChI=1S/C15H18N4O/c1-10(2)19-7-11-3-4-13(5-12(11)8-19)18-15(20)14-6-16-9-17-14/h3-6,9-10H,7-8H2,1-2H3,(H,16,17)(H,18,20) |
| InChIKey | HTOZGKGLQORTLI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide?
The IUPAC name of N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide (CID 110475376) is N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide.
What is the SMILES notation for N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide?
The canonical SMILES for N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide is CC(C)N1Cc2ccc(NC(=O)c3cnc[nH]3)cc2C1.
What is the InChIKey of N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide?
The InChIKey is HTOZGKGLQORTLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O/c1-10(2)19-7-11-3-4-13(5-12(11)8-19)18-15(20)14-6-16-9-17-14/h3-6,9-10H,7-8H2,1-2H3,(H,16,17)(H,18,20).
What are the key properties of N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide?
N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide has a molecular weight of 270.34 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-propan-2-yl-1,3-dihydroisoindol-5-yl)-1H-imidazole-5-carboxamide is sourced from PubChem (CID 110475376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).