About [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane
[(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11047551) has the molecular formula C16H33IOSi
and a molecular weight of 396.43 g/mol. Its IUPAC name is [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 11047551 |
| Molecular Formula | C16H33IOSi |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC[C@@H](/C=C\CCI)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H33IOSi/c1-8-16(11-9-10-12-17)18-19(13(2)3,14(4)5)15(6)7/h9,11,13-16H,8,10,12H2,1-7H3/b11-9-/t16-/m0/s1 |
| InChIKey | UGBZXYIQWDPTQX-SLWQEBJJSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane (CID 11047551) is [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane is CC[C@@H](/C=C\CCI)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is UGBZXYIQWDPTQX-SLWQEBJJSA-N. The full InChI is InChI=1S/C16H33IOSi/c1-8-16(11-9-10-12-17)18-19(13(2)3,14(4)5)15(6)7/h9,11,13-16H,8,10,12H2,1-7H3/b11-9-/t16-/m0/s1.
What are the key properties of [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane?
[(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 396.43 g/mol, XLogP of 6.34, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,3S)-7-iodohept-4-en-3-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 11047551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).