About 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate
2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate (PubChem CID 11047568) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate |
| PubChem CID | 11047568 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate |
| SMILES | CCOc1ccc(CCOC(=O)N2CCN(CCCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-2-28-23-12-10-22(11-13-23)14-20-29-24(27)26-18-16-25(17-19-26)15-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-13H,2,6,9,14-20H2,1H3 |
| InChIKey | FOQLLAFYKYEUAL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate?
The IUPAC name of 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate (CID 11047568) is 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate.
What is the SMILES notation for 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate?
The canonical SMILES for 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate is CCOc1ccc(CCOC(=O)N2CCN(CCCc3ccccc3)CC2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate?
The InChIKey is FOQLLAFYKYEUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O3/c1-2-28-23-12-10-22(11-13-23)14-20-29-24(27)26-18-16-25(17-19-26)15-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-13H,2,6,9,14-20H2,1H3.
What are the key properties of 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate?
2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate has a molecular weight of 396.53 g/mol, XLogP of 4.01, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)ethyl 4-(3-phenylpropyl)piperazine-1-carboxylate is sourced from PubChem (CID 11047568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).