C22H19N7O — CID 11047588
8-(2-aminopyrimidin-4-yl)-N-benzyl-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-13-amine (PubChem CID 11047588) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 8-(2-aminopyrimidin-4-yl)-N-benzyl-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-13-amine.
| Compound Name | 8-(2-aminopyrimidin-4-yl)-N-benzyl-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-13-amine |
|---|---|
| PubChem CID | 11047588 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 8-(2-aminopyrimidin-4-yl)-N-benzyl-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-13-amine |
| SMILES | COc1ccnc2c1c(-c1ccnc(N)n1)c1ccnc(NCc3ccccc3)n12 |
| InChI | InChI=1S/C22H19N7O/c1-30-17-9-12-24-20-19(17)18(15-7-10-25-21(23)28-15)16-8-11-26-22(29(16)20)27-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,26,27)(H2,23,25,28) |
| InChIKey | DTIJSCFDKJVDAY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |