About 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide
4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 1104762) has the molecular formula C19H18N4O4
and a molecular weight of 366.38 g/mol. Its IUPAC name is 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
| PubChem CID | 1104762 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)c1nc[nH]c1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C19H18N4O4/c1-26-14-9-5-3-7-12(14)22-18(24)16-17(21-11-20-16)19(25)23-13-8-4-6-10-15(13)27-2/h3-11H,1-2H3,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | VCUKLUJYKUXHKQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide?
The IUPAC name of 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide (CID 1104762) is 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide.
What is the SMILES notation for 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide?
The canonical SMILES for 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide is COc1ccccc1NC(=O)c1nc[nH]c1C(=O)Nc1ccccc1OC.
What is the InChIKey of 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide?
The InChIKey is VCUKLUJYKUXHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O4/c1-26-14-9-5-3-7-12(14)22-18(24)16-17(21-11-20-16)19(25)23-13-8-4-6-10-15(13)27-2/h3-11H,1-2H3,(H,20,21)(H,22,24)(H,23,25).
What are the key properties of 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide?
4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide has a molecular weight of 366.38 g/mol, XLogP of 2.93, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-N-bis(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide is sourced from PubChem (CID 1104762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).