C21H33N7O — CID 11047639
2-[(3R,5S)-4-[2-[(1R)-1-butoxyethyl]pyrimidin-4-yl]-3,5-dimethylpiperazin-1-yl]-4,6-dimethyl-1,3,5-triazine (PubChem CID 11047639) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[(3R,5S)-4-[2-[(1R)-1-butoxyethyl]pyrimidin-4-yl]-3,5-dimethylpiperazin-1-yl]-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-[(3R,5S)-4-[2-[(1R)-1-butoxyethyl]pyrimidin-4-yl]-3,5-dimethylpiperazin-1-yl]-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 11047639 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2-[(3R,5S)-4-[2-[(1R)-1-butoxyethyl]pyrimidin-4-yl]-3,5-dimethylpiperazin-1-yl]-4,6-dimethyl-1,3,5-triazine |
| SMILES | CCCCO[C@H](C)c1nccc(N2[C@H](C)CN(c3nc(C)nc(C)n3)C[C@@H]2C)n1 |
| InChI | InChI=1S/C21H33N7O/c1-7-8-11-29-16(4)20-22-10-9-19(26-20)28-14(2)12-27(13-15(28)3)21-24-17(5)23-18(6)25-21/h9-10,14-16H,7-8,11-13H2,1-6H3/t14-,15+,16-/m1/s1 |
| InChIKey | BHGUMNVSMZQVKG-OWCLPIDISA-N |
| XLogP | 3.26 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|