C15H18FNO2 — CID 110477392
N-[1-(4-fluorophenyl)cyclopentyl]-3-oxobutanamide (PubChem CID 110477392) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)cyclopentyl]-3-oxobutanamide.
| Compound Name | N-[1-(4-fluorophenyl)cyclopentyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 110477392 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)cyclopentyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C15H18FNO2/c1-11(18)10-14(19)17-15(8-2-3-9-15)12-4-6-13(16)7-5-12/h4-7H,2-3,8-10H2,1H3,(H,17,19) |
| InChIKey | VOGBUUAFWLWKGM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|