C23H39NO3S — CID 11047864
tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylheptan-2-yl]carbamate (PubChem CID 11047864) has the molecular formula C23H39NO3S and a molecular weight of 409.64 g/mol. Its IUPAC name is tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 11047864 |
| Molecular Formula | C23H39NO3S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | tert-butyl N-(tert-butylsulfanylmethyl)-N-[(1R,2S)-1-hydroxy-1-phenylheptan-2-yl]carbamate |
| SMILES | CCCCC[C@@H]([C@H](O)c1ccccc1)N(CSC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39NO3S/c1-8-9-11-16-19(20(25)18-14-12-10-13-15-18)24(17-28-23(5,6)7)21(26)27-22(2,3)4/h10,12-15,19-20,25H,8-9,11,16-17H2,1-7H3/t19-,20+/m0/s1 |
| InChIKey | VRZTWDQDQYFWKO-VQTJNVASSA-N |
| XLogP | 6.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|