C16H38O6Si3 — CID 11047886
[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol (PubChem CID 11047886) has the molecular formula C16H38O6Si3 and a molecular weight of 410.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11047886 |
| Molecular Formula | C16H38O6Si3 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methanol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H38O6Si3/c1-18-16-15(22-25(8,9)10)14(21-24(5,6)7)13(12(11-17)19-16)20-23(2,3)4/h12-17H,11H2,1-10H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | VFMWHUHHZDIWSF-LJIZCISZSA-N |
| XLogP | 3.01 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|