C24H20N4O3 — CID 11047906
1-benzyl-3-[(4-methoxyphenyl)methyl]purino[7,8-a]pyridine-2,4-dione (PubChem CID 11047906) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-benzyl-3-[(4-methoxyphenyl)methyl]purino[7,8-a]pyridine-2,4-dione.
| Compound Name | 1-benzyl-3-[(4-methoxyphenyl)methyl]purino[7,8-a]pyridine-2,4-dione |
|---|---|
| PubChem CID | 11047906 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-benzyl-3-[(4-methoxyphenyl)methyl]purino[7,8-a]pyridine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)c3c(nc4ccccn43)n(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-31-19-12-10-18(11-13-19)16-28-23(29)21-22(25-20-9-5-6-14-26(20)21)27(24(28)30)15-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3 |
| InChIKey | RLTXMMRGUODGAP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |